Organic compounds
Filtered Search Results
Thermo Scientific Chemicals Alginic acid, sodium salt
CAS: 9005-38-3 Molecular Formula: (C6H7O7)A(C6H7O7)BNa MDL Number: MFCD00081310 Synonym: Algin,Sodium alginate
| CAS | 9005-38-3 |
|---|---|
| MDL Number | MFCD00081310 |
| Synonym | Algin,Sodium alginate |
| Molecular Formula | (C6H7O7)A(C6H7O7)BNa |
Vitamin B12, 98+% (dry wt basis)
CAS: 68-19-9 Molecular Formula: C63H88CoN14O14P Molecular Weight (g/mol): 1355.39 MDL Number: MFCD00151092 InChI Key: YUWVGNQGDAPKCX-BVWPOUIRNA-L Synonym: vitamin b12 PubChem CID: 129893524 IUPAC Name: cobalt(2+);[(2R,3S,4R,5S)-5-(5,6-dimethylbenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] [(2R)-1-[3-[(1R,2R,3R,5Z,7S,10Z,12S,13S,15Z,17S,18S,19R)-2,13,18-tris(2-amino-2-oxoethyl)-7,12,17-tris(3-amino-3-oxopropyl)-3,5,8,8,13,15,18,19-octamethyl- SMILES: [C@@H]1(C2=CC3=[N+]4C(C(C3(C)C)CCC(N)=O)=C(C3=[N+]5C6C7(N8C(C([C@@]7(C)CC(N)=O)CCC(N)=O)=C(C(=[N+]2[Co+]458([N+]2=CN(C4=CC(=C(C)C=C24)C)[C@@]2([H])O[C@@H]([C@]([H])(OP([O-])(=O)OC(C)CNC(=O)CCC3(C)[C@@H]6CC(N)=O)C2O)CO)C#N)C1(C)CC(N)=O)C)C)C)CCC(N)=O
| PubChem CID | 129893524 |
|---|---|
| CAS | 68-19-9 |
| Molecular Weight (g/mol) | 1355.39 |
| MDL Number | MFCD00151092 |
| SMILES | [C@@H]1(C2=CC3=[N+]4C(C(C3(C)C)CCC(N)=O)=C(C3=[N+]5C6C7(N8C(C([C@@]7(C)CC(N)=O)CCC(N)=O)=C(C(=[N+]2[Co+]458([N+]2=CN(C4=CC(=C(C)C=C24)C)[C@@]2([H])O[C@@H]([C@]([H])(OP([O-])(=O)OC(C)CNC(=O)CCC3(C)[C@@H]6CC(N)=O)C2O)CO)C#N)C1(C)CC(N)=O)C)C)C)CCC(N)=O |
| Synonym | vitamin b12 |
| IUPAC Name | cobalt(2+);[(2R,3S,4R,5S)-5-(5,6-dimethylbenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] [(2R)-1-[3-[(1R,2R,3R,5Z,7S,10Z,12S,13S,15Z,17S,18S,19R)-2,13,18-tris(2-amino-2-oxoethyl)-7,12,17-tris(3-amino-3-oxopropyl)-3,5,8,8,13,15,18,19-octamethyl- |
| InChI Key | YUWVGNQGDAPKCX-BVWPOUIRNA-L |
| Molecular Formula | C63H88CoN14O14P |
Triethylamine trihydrofluoride, ca. 37% HF
CAS: 73602-61-6 Molecular Formula: C6H15N·3HF Molecular Weight (g/mol): 161.21 MDL Number: MFCD00043294 InChI Key: IKGLACJFEHSFNN-UHFFFAOYSA-N Synonym: triethylamine trihydrofluoride,n,n-diethylethanamine trihydrofluoride,triethylammonium fluoride,ethanamine, n,n-diethyl-, trihydrofluoride,triethylamine trishydrofluoride,hydrogen fluoride in triethylamine,hf in triethylamine,triethylaminetrihydrofluoride,hydrogen fluoride triethylamine,ethanamine, n,n-diethyl-, hydrofluoride 1:3 PubChem CID: 175505 IUPAC Name: N,N-diethylethanamine;trihydrofluoride SMILES: CCN(CC)CC.F.F.F
| PubChem CID | 175505 |
|---|---|
| CAS | 73602-61-6 |
| Molecular Weight (g/mol) | 161.21 |
| MDL Number | MFCD00043294 |
| SMILES | CCN(CC)CC.F.F.F |
| Synonym | triethylamine trihydrofluoride,n,n-diethylethanamine trihydrofluoride,triethylammonium fluoride,ethanamine, n,n-diethyl-, trihydrofluoride,triethylamine trishydrofluoride,hydrogen fluoride in triethylamine,hf in triethylamine,triethylaminetrihydrofluoride,hydrogen fluoride triethylamine,ethanamine, n,n-diethyl-, hydrofluoride 1:3 |
| IUPAC Name | N,N-diethylethanamine;trihydrofluoride |
| InChI Key | IKGLACJFEHSFNN-UHFFFAOYSA-N |
| Molecular Formula | C6H15N·3HF |
Styrene, 99.5%, for analysis, stabilized
CAS: 100-42-5 Molecular Formula: C8H8 Molecular Weight (g/mol): 104.15 MDL Number: MFCD00008612,MFCD00084450 InChI Key: PPBRXRYQALVLMV-UHFFFAOYSA-N Synonym: ethenylbenzene,phenylethylene,vinylbenzene,styrol,benzene, ethenyl,cinnamene,phenylethene,monomer,phenethylene,styrolene PubChem CID: 7501 ChEBI: CHEBI:27452 IUPAC Name: styrene SMILES: C=CC1=CC=CC=C1
| PubChem CID | 7501 |
|---|---|
| CAS | 100-42-5 |
| Molecular Weight (g/mol) | 104.15 |
| ChEBI | CHEBI:27452 |
| MDL Number | MFCD00008612,MFCD00084450 |
| SMILES | C=CC1=CC=CC=C1 |
| Synonym | ethenylbenzene,phenylethylene,vinylbenzene,styrol,benzene, ethenyl,cinnamene,phenylethene,monomer,phenethylene,styrolene |
| IUPAC Name | styrene |
| InChI Key | PPBRXRYQALVLMV-UHFFFAOYSA-N |
| Molecular Formula | C8H8 |
Acetic Anhydride, ACS, MilliporeSigma™
CAS: 108-24-7 Molecular Formula: C4H6O3 Molecular Weight (g/mol): 102.089 InChI Key: WFDIJRYMOXRFFG-UHFFFAOYSA-N Synonym: acetic anhydride,acetanhydride,acetic acid, anhydride,acetic oxide,acetyl oxide,ethanoic anhydride,acetyl ether,acetyl anhydride,acetic acid anhydride,anhydride acetique PubChem CID: 7918 ChEBI: CHEBI:36610 IUPAC Name: acetyl acetate SMILES: CC(=O)OC(=O)C
| PubChem CID | 7918 |
|---|---|
| CAS | 108-24-7 |
| Molecular Weight (g/mol) | 102.089 |
| ChEBI | CHEBI:36610 |
| SMILES | CC(=O)OC(=O)C |
| Synonym | acetic anhydride,acetanhydride,acetic acid, anhydride,acetic oxide,acetyl oxide,ethanoic anhydride,acetyl ether,acetyl anhydride,acetic acid anhydride,anhydride acetique |
| IUPAC Name | acetyl acetate |
| InChI Key | WFDIJRYMOXRFFG-UHFFFAOYSA-N |
| Molecular Formula | C4H6O3 |
Tetra-n-butylammonium hydroxide, 1.0M in methanol
CAS: 2052-49-5 Molecular Formula: C16H37NO Molecular Weight (g/mol): 259.48 MDL Number: MFCD00009425 InChI Key: VDZOOKBUILJEDG-UHFFFAOYSA-M Synonym: tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 PubChem CID: 2723671 SMILES: [OH-].CCCC[N+](CCCC)(CCCC)CCCC
| PubChem CID | 2723671 |
|---|---|
| CAS | 2052-49-5 |
| Molecular Weight (g/mol) | 259.48 |
| MDL Number | MFCD00009425 |
| SMILES | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| Synonym | tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 |
| InChI Key | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| Molecular Formula | C16H37NO |
N,N-Diethyl-p-phenylenediamine oxalate, 96%
CAS: 62637-92-7 Molecular Formula: 0·5 C2H2O4 Molecular Weight (g/mol): 209.27 MDL Number: MFCD00070242
| CAS | 62637-92-7 |
|---|---|
| Molecular Weight (g/mol) | 209.27 |
| MDL Number | MFCD00070242 |
| Molecular Formula | 0·5 C2H2O4 |
Thermo Scientific Chemicals Diethylenetriaminepentaacetic acid, pentasodium salt, tech., 40% aqueous solution
CAS: 140-01-2 | C14H18N3Na5O10 | 503.26 g/mol
| Linear Formula | NaOCOCH2N(CH2CH2N(CH2COONa)2)2 |
|---|---|
| Molecular Weight (g/mol) | 503.26 |
| InChI Key | LQPLDXQVILYOOL-UHFFFAOYSA-I |
| Density | 1.2900g/mL |
| PubChem CID | 8779 |
| Name Note | 40% Aqueous Solution |
| Percent Purity | 39 to 41% |
| pH | 11.0 to 12.0 (1% aq. soln.) |
| Formula Weight | 503.26 |
| Melting Point | -40°C |
| Boiling Point | 106°C |
| Physical Form | Solution |
| Chemical Name or Material | Diethylenetriaminepentaacetic acid, pentasodium salt |
| Grade | Technical |
| SMILES | [Na+].[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wash face,hands and any exposed skin thoroughly after handling. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Cont |
| MDL Number | MFCD00051016 |
| Health Hazard 2 | GHS H Statement Causes serious eye irritation. |
| Solubility Information | Solubility in water: soluble. Other solubilities: mixible with many organic solvents |
| Packaging | Glass bottle |
| Flash Point | >100°C |
| Health Hazard 1 | GHS Signal Word: Warning |
| Refractive Index | 1.4185 to 1.4205 |
| Synonym | pentasodium dtpa,tetralon b,trilon c,versenex 80,pentasodium pentetate,hamp-ex 80,detarex py,kiresuto p,chelest p,plexene d |
| IUPAC Name | pentasodium;2-[bis[2-[bis(carboxylatomethyl)amino]ethyl]amino]acetate |
| Beilstein | 04, III, 1190 |
| Molecular Formula | C14H18N3Na5O10 |
| EINECS Number | 205-391-3 |
| Specific Gravity | 1.29 |
Acetamide, 99%, pure
CAS: 60-35-5 Molecular Formula: C2H5NO Molecular Weight (g/mol): 59.06 InChI Key: DLFVBJFMPXGRIB-UHFFFAOYSA-N Synonym: ethanamide,acetic acid amide,methanecarboxamide,acetimidic acid,amide c2,ethanimidic acid,acetamid,amid kyseliny octove,caswell no. 003h,acetimidic acid van PubChem CID: 178 ChEBI: CHEBI:49028 IUPAC Name: acetamide SMILES: CC(=O)N
| PubChem CID | 178 |
|---|---|
| CAS | 60-35-5 |
| Molecular Weight (g/mol) | 59.06 |
| ChEBI | CHEBI:49028 |
| SMILES | CC(=O)N |
| Synonym | ethanamide,acetic acid amide,methanecarboxamide,acetimidic acid,amide c2,ethanimidic acid,acetamid,amid kyseliny octove,caswell no. 003h,acetimidic acid van |
| IUPAC Name | acetamide |
| InChI Key | DLFVBJFMPXGRIB-UHFFFAOYSA-N |
| Molecular Formula | C2H5NO |
Citric acid monohydrate, 99+%, ACS reagent
CAS: 5949-29-1 Molecular Formula: C6H8O7·H2O Molecular Weight (g/mol): 210.15 InChI Key: YASYEJJMZJALEJ-UHFFFAOYSA-N Synonym: citric acid monohydrate,citric acid hydrate,2-hydroxypropane-1,2,3-tricarboxylic acid hydrate,citric acid, monohydrate,unii-2968phw8qp,1,2,3-propanetricarboxylic acid, 2-hydroxy-, monohydrate,citrate,acidum citricum monohydricum,citric acid monohydrate usp PubChem CID: 22230 ChEBI: CHEBI:31404 IUPAC Name: 2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate SMILES: C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O
| PubChem CID | 22230 |
|---|---|
| CAS | 5949-29-1 |
| Molecular Weight (g/mol) | 210.15 |
| ChEBI | CHEBI:31404 |
| SMILES | C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O |
| Synonym | citric acid monohydrate,citric acid hydrate,2-hydroxypropane-1,2,3-tricarboxylic acid hydrate,citric acid, monohydrate,unii-2968phw8qp,1,2,3-propanetricarboxylic acid, 2-hydroxy-, monohydrate,citrate,acidum citricum monohydricum,citric acid monohydrate usp |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate |
| InChI Key | YASYEJJMZJALEJ-UHFFFAOYSA-N |
| Molecular Formula | C6H8O7·H2O |
1,1,1,3,3,3-Hexafluoro-2-propanol, 99.9%, for spectroscopy
CAS: 920-66-1 MDL Number: MFCD00011651 InChI Key: BYEAHWXPCBROCE-UHFFFAOYSA-N Synonym: 1,1,1,3,3,3-hexafluoro-2-propanol,hexafluoroisopropanol,hfip,hexafluoro-2-propanol,hexafluoroisopropyl alcohol,bis trifluoromethyl methanol,1,1,1,3,3,3-hexafluoroisopropanol,2h-hexafluoroisopropanol,2-propanol, 1,1,1,3,3,3-hexafluoro,1,1,1,3,3,3-hexafluoroisopropyl alcohol PubChem CID: 13529 ChEBI: CHEBI:63104 IUPAC Name: 1,1,1,3,3,3-hexafluoropropan-2-ol SMILES: C(C(F)(F)F)(C(F)(F)F)O
| PubChem CID | 13529 |
|---|---|
| CAS | 920-66-1 |
| ChEBI | CHEBI:63104 |
| MDL Number | MFCD00011651 |
| SMILES | C(C(F)(F)F)(C(F)(F)F)O |
| Synonym | 1,1,1,3,3,3-hexafluoro-2-propanol,hexafluoroisopropanol,hfip,hexafluoro-2-propanol,hexafluoroisopropyl alcohol,bis trifluoromethyl methanol,1,1,1,3,3,3-hexafluoroisopropanol,2h-hexafluoroisopropanol,2-propanol, 1,1,1,3,3,3-hexafluoro,1,1,1,3,3,3-hexafluoroisopropyl alcohol |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-ol |
| InChI Key | BYEAHWXPCBROCE-UHFFFAOYSA-N |
Ethylenediaminetetraacetic acid disodium salt, 0.100N (0.050M) Standardized solution
CAS: 139-33-3 Molecular Formula: C10H14N2Na2O8 Molecular Weight (g/mol): 336.21 MDL Number: MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 InChI Key: ZGTMUACCHSMWAC-UHFFFAOYSA-L Synonym: ethylenediaminetetraacetic acid disodium salt,edta na2,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid PubChem CID: 57339238 ChEBI: CHEBI:64734 IUPAC Name: disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate SMILES: [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 57339238 |
|---|---|
| CAS | 139-33-3 |
| Molecular Weight (g/mol) | 336.21 |
| ChEBI | CHEBI:64734 |
| MDL Number | MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 |
| SMILES | [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | ethylenediaminetetraacetic acid disodium salt,edta na2,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid |
| IUPAC Name | disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate |
| InChI Key | ZGTMUACCHSMWAC-UHFFFAOYSA-L |
| Molecular Formula | C10H14N2Na2O8 |
Furfuryl Alcohol, 98%
CAS: 98-00-0 Molecular Formula: C5H6O2 Molecular Weight (g/mol): 98.1 MDL Number: MFCD00003252 InChI Key: XPFVYQJUAUNWIW-UHFFFAOYSA-N Synonym: furfuryl alcohol,2-furanmethanol,2-furylmethanol,2-furancarbinol,2-furylcarbinol,furfuranol,2-furanylmethanol,furfural alcohol,2-furfuryl alcohol,5-hydroxymethylfuran PubChem CID: 7361 ChEBI: CHEBI:207496 IUPAC Name: furan-2-ylmethanol SMILES: C1=COC(=C1)CO
| PubChem CID | 7361 |
|---|---|
| CAS | 98-00-0 |
| Molecular Weight (g/mol) | 98.1 |
| ChEBI | CHEBI:207496 |
| MDL Number | MFCD00003252 |
| SMILES | C1=COC(=C1)CO |
| Synonym | furfuryl alcohol,2-furanmethanol,2-furylmethanol,2-furancarbinol,2-furylcarbinol,furfuranol,2-furanylmethanol,furfural alcohol,2-furfuryl alcohol,5-hydroxymethylfuran |
| IUPAC Name | furan-2-ylmethanol |
| InChI Key | XPFVYQJUAUNWIW-UHFFFAOYSA-N |
| Molecular Formula | C5H6O2 |
Urea, ultrapure, 99%
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.056 MDL Number: MFCD00008022 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.056 |
| ChEBI | CHEBI:48376 |
| MDL Number | MFCD00008022 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Propylene carbonate, 99.5%
CAS: 108-32-7 Molecular Formula: C4H6O3 Molecular Weight (g/mol): 102.09 MDL Number: MFCD00005385,MFCD00798264,MFCD00798265 InChI Key: RUOJZAUFBMNUDX-UHFFFAOYNA-N Synonym: propylene carbonate,1,2-propylene carbonate,1,2-propanediol cyclic carbonate,texacar pc,1,3-dioxolan-2-one, 4-methyl,cyclic propylene carbonate,arconate 5000,1,2-propanediol carbonate,1-methylethylene carbonate,cyclic 1,2-propylene carbonate PubChem CID: 7924 IUPAC Name: 4-methyl-1,3-dioxolan-2-one SMILES: CC1COC(=O)O1
| PubChem CID | 7924 |
|---|---|
| CAS | 108-32-7 |
| Molecular Weight (g/mol) | 102.09 |
| MDL Number | MFCD00005385,MFCD00798264,MFCD00798265 |
| SMILES | CC1COC(=O)O1 |
| Synonym | propylene carbonate,1,2-propylene carbonate,1,2-propanediol cyclic carbonate,texacar pc,1,3-dioxolan-2-one, 4-methyl,cyclic propylene carbonate,arconate 5000,1,2-propanediol carbonate,1-methylethylene carbonate,cyclic 1,2-propylene carbonate |
| IUPAC Name | 4-methyl-1,3-dioxolan-2-one |
| InChI Key | RUOJZAUFBMNUDX-UHFFFAOYNA-N |
| Molecular Formula | C4H6O3 |